C25H38O4S2 — CID 14097583
3-[2-carboxyethylsulfanyl-[2-[(E)-dodec-1-enyl]phenyl]methyl]sulfanylpropanoic acid (PubChem CID 14097583) has the molecular formula C25H38O4S2 and a molecular weight of 466.71 g/mol. Its IUPAC name is 3-[2-carboxyethylsulfanyl-[2-[(E)-dodec-1-enyl]phenyl]methyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-carboxyethylsulfanyl-[2-[(E)-dodec-1-enyl]phenyl]methyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 14097583 |
| Molecular Formula | C25H38O4S2 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-[2-carboxyethylsulfanyl-[2-[(E)-dodec-1-enyl]phenyl]methyl]sulfanylpropanoic acid |
| SMILES | CCCCCCCCCC/C=C/c1ccccc1C(SCCC(=O)O)SCCC(=O)O |
| InChI | InChI=1S/C25H38O4S2/c1-2-3-4-5-6-7-8-9-10-11-14-21-15-12-13-16-22(21)25(30-19-17-23(26)27)31-20-18-24(28)29/h11-16,25H,2-10,17-20H2,1H3,(H,26,27)(H,28,29)/b14-11+ |
| InChIKey | USNXDIGYHYCXRZ-SDNWHVSQSA-N |
| XLogP | 7.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|