About 2-hept-1-enylbenzoic acid
2-hept-1-enylbenzoic acid (PubChem CID 70379014) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-hept-1-enylbenzoic acid.
Molecular Properties
| Compound Name | 2-hept-1-enylbenzoic acid |
| PubChem CID | 70379014 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-hept-1-enylbenzoic acid |
| SMILES | CCCCCC=Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H18O2/c1-2-3-4-5-6-9-12-10-7-8-11-13(12)14(15)16/h6-11H,2-5H2,1H3,(H,15,16) |
| InChIKey | HWYRCGUBULTIBF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hept-1-enylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hept-1-enylbenzoic acid?
The IUPAC name of 2-hept-1-enylbenzoic acid (CID 70379014) is 2-hept-1-enylbenzoic acid.
What is the SMILES notation for 2-hept-1-enylbenzoic acid?
The canonical SMILES for 2-hept-1-enylbenzoic acid is CCCCCC=Cc1ccccc1C(=O)O.
What is the InChIKey of 2-hept-1-enylbenzoic acid?
The InChIKey is HWYRCGUBULTIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-2-3-4-5-6-9-12-10-7-8-11-13(12)14(15)16/h6-11H,2-5H2,1H3,(H,15,16).
What are the key properties of 2-hept-1-enylbenzoic acid?
2-hept-1-enylbenzoic acid has a molecular weight of 218.30 g/mol, XLogP of 3.98, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hept-1-enylbenzoic acid is sourced from PubChem (CID 70379014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).