About decane;phthalic acid
decane;phthalic acid (PubChem CID 158763790) has the molecular formula C18H28O4
and a molecular weight of 308.42 g/mol. Its IUPAC name is decane;phthalic acid.
Molecular Properties
| Compound Name | decane;phthalic acid |
| PubChem CID | 158763790 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | decane;phthalic acid |
| SMILES | CCCCCCCCCC.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C10H22.C8H6O4/c1-3-5-7-9-10-8-6-4-2;9-7(10)5-3-1-2-4-6(5)8(11)12/h3-10H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | IOZQXENUDVQOOY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane;phthalic acid?
The IUPAC name of decane;phthalic acid (CID 158763790) is decane;phthalic acid.
What is the SMILES notation for decane;phthalic acid?
The canonical SMILES for decane;phthalic acid is CCCCCCCCCC.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of decane;phthalic acid?
The InChIKey is IOZQXENUDVQOOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.C8H6O4/c1-3-5-7-9-10-8-6-4-2;9-7(10)5-3-1-2-4-6(5)8(11)12/h3-10H2,1-2H3;1-4H,(H,9,10)(H,11,12).
What are the key properties of decane;phthalic acid?
decane;phthalic acid has a molecular weight of 308.42 g/mol, XLogP of 5.23, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decane;phthalic acid is sourced from PubChem (CID 158763790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).