About azane;2-octylbenzoic acid
azane;2-octylbenzoic acid (PubChem CID 70171834) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is azane;2-octylbenzoic acid.
Molecular Properties
| Compound Name | azane;2-octylbenzoic acid |
| PubChem CID | 70171834 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | azane;2-octylbenzoic acid |
| SMILES | CCCCCCCCc1ccccc1C(=O)O.N |
| InChI | InChI=1S/C15H22O2.H3N/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15(16)17;/h8-9,11-12H,2-7,10H2,1H3,(H,16,17);1H3 |
| InChIKey | ZOSBVSSUYLNJAF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;2-octylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-octylbenzoic acid?
The IUPAC name of azane;2-octylbenzoic acid (CID 70171834) is azane;2-octylbenzoic acid.
What is the SMILES notation for azane;2-octylbenzoic acid?
The canonical SMILES for azane;2-octylbenzoic acid is CCCCCCCCc1ccccc1C(=O)O.N.
What is the InChIKey of azane;2-octylbenzoic acid?
The InChIKey is ZOSBVSSUYLNJAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2.H3N/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15(16)17;/h8-9,11-12H,2-7,10H2,1H3,(H,16,17);1H3.
What are the key properties of azane;2-octylbenzoic acid?
azane;2-octylbenzoic acid has a molecular weight of 251.37 g/mol, XLogP of 4.45, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-octylbenzoic acid is sourced from PubChem (CID 70171834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).