About azane;2-butylbenzoic acid
azane;2-butylbenzoic acid (PubChem CID 174819524) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is azane;2-butylbenzoic acid.
Molecular Properties
| Compound Name | azane;2-butylbenzoic acid |
| PubChem CID | 174819524 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | azane;2-butylbenzoic acid |
| SMILES | CCCCc1ccccc1C(=O)O.N |
| InChI | InChI=1S/C11H14O2.H3N/c1-2-3-6-9-7-4-5-8-10(9)11(12)13;/h4-5,7-8H,2-3,6H2,1H3,(H,12,13);1H3 |
| InChIKey | FABGGTIXNHGRNM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-butylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-butylbenzoic acid?
The IUPAC name of azane;2-butylbenzoic acid (CID 174819524) is azane;2-butylbenzoic acid.
What is the SMILES notation for azane;2-butylbenzoic acid?
The canonical SMILES for azane;2-butylbenzoic acid is CCCCc1ccccc1C(=O)O.N.
What is the InChIKey of azane;2-butylbenzoic acid?
The InChIKey is FABGGTIXNHGRNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.H3N/c1-2-3-6-9-7-4-5-8-10(9)11(12)13;/h4-5,7-8H,2-3,6H2,1H3,(H,12,13);1H3.
What are the key properties of azane;2-butylbenzoic acid?
azane;2-butylbenzoic acid has a molecular weight of 195.26 g/mol, XLogP of 2.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-butylbenzoic acid is sourced from PubChem (CID 174819524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).