About 2-butylbenzamide
2-butylbenzamide (PubChem CID 15468173) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-butylbenzamide.
Molecular Properties
| Compound Name | 2-butylbenzamide |
| PubChem CID | 15468173 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-butylbenzamide |
| SMILES | CCCCc1ccccc1C(N)=O |
| InChI | InChI=1S/C11H15NO/c1-2-3-6-9-7-4-5-8-10(9)11(12)13/h4-5,7-8H,2-3,6H2,1H3,(H2,12,13) |
| InChIKey | HEFNEJFJFIYIDG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylbenzamide?
The IUPAC name of 2-butylbenzamide (CID 15468173) is 2-butylbenzamide.
What is the SMILES notation for 2-butylbenzamide?
The canonical SMILES for 2-butylbenzamide is CCCCc1ccccc1C(N)=O.
What is the InChIKey of 2-butylbenzamide?
The InChIKey is HEFNEJFJFIYIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-2-3-6-9-7-4-5-8-10(9)11(12)13/h4-5,7-8H,2-3,6H2,1H3,(H2,12,13).
What are the key properties of 2-butylbenzamide?
2-butylbenzamide has a molecular weight of 177.25 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylbenzamide is sourced from PubChem (CID 15468173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).