About 2-octylbenzamide
2-octylbenzamide (PubChem CID 11148995) has the molecular formula C15H23NO
and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-octylbenzamide.
Molecular Properties
| Compound Name | 2-octylbenzamide |
| PubChem CID | 11148995 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-octylbenzamide |
| SMILES | CCCCCCCCc1ccccc1C(N)=O |
| InChI | InChI=1S/C15H23NO/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15(16)17/h8-9,11-12H,2-7,10H2,1H3,(H2,16,17) |
| InChIKey | OWKWDWLWUBFWPX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylbenzamide?
The IUPAC name of 2-octylbenzamide (CID 11148995) is 2-octylbenzamide.
What is the SMILES notation for 2-octylbenzamide?
The canonical SMILES for 2-octylbenzamide is CCCCCCCCc1ccccc1C(N)=O.
What is the InChIKey of 2-octylbenzamide?
The InChIKey is OWKWDWLWUBFWPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15(16)17/h8-9,11-12H,2-7,10H2,1H3,(H2,16,17).
What are the key properties of 2-octylbenzamide?
2-octylbenzamide has a molecular weight of 233.36 g/mol, XLogP of 3.69, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylbenzamide is sourced from PubChem (CID 11148995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).