About magnesium bis(2-hexylbenzoate)
magnesium bis(2-hexylbenzoate) (PubChem CID 70520345) has the molecular formula C26H34MgO4
and a molecular weight of 434.86 g/mol. Its IUPAC name is magnesium bis(2-hexylbenzoate).
Molecular Properties
| Compound Name | magnesium bis(2-hexylbenzoate) |
| PubChem CID | 70520345 |
| Molecular Formula | C26H34MgO4 |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | magnesium bis(2-hexylbenzoate) |
| SMILES | CCCCCCc1ccccc1C(=O)[O-].CCCCCCc1ccccc1C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C13H18O2.Mg/c2*1-2-3-4-5-8-11-9-6-7-10-12(11)13(14)15;/h2*6-7,9-10H,2-5,8H2,1H3,(H,14,15);/q;;+2/p-2 |
| InChIKey | YDELKIDEOHFBJL-UHFFFAOYSA-L |
| XLogP | 3.96 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(2-hexylbenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2-hexylbenzoate)?
The IUPAC name of magnesium bis(2-hexylbenzoate) (CID 70520345) is magnesium bis(2-hexylbenzoate).
What is the SMILES notation for magnesium bis(2-hexylbenzoate)?
The canonical SMILES for magnesium bis(2-hexylbenzoate) is CCCCCCc1ccccc1C(=O)[O-].CCCCCCc1ccccc1C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(2-hexylbenzoate)?
The InChIKey is YDELKIDEOHFBJL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H18O2.Mg/c2*1-2-3-4-5-8-11-9-6-7-10-12(11)13(14)15;/h2*6-7,9-10H,2-5,8H2,1H3,(H,14,15);/q;;+2/p-2.
What are the key properties of magnesium bis(2-hexylbenzoate)?
magnesium bis(2-hexylbenzoate) has a molecular weight of 434.86 g/mol, XLogP of 3.96, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2-hexylbenzoate) is sourced from PubChem (CID 70520345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).