About potassium 2-pentylbenzoate
potassium 2-pentylbenzoate (PubChem CID 175429572) has the molecular formula C12H15KO2
and a molecular weight of 230.35 g/mol. Its IUPAC name is potassium 2-pentylbenzoate.
Molecular Properties
| Compound Name | potassium 2-pentylbenzoate |
| PubChem CID | 175429572 |
| Molecular Formula | C12H15KO2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | potassium 2-pentylbenzoate |
| SMILES | CCCCCc1ccccc1C(=O)[O-].[K+] |
| InChI | InChI=1S/C12H16O2.K/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14;/h5-6,8-9H,2-4,7H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | GKIUYYNPIXLGNP-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-pentylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-pentylbenzoate?
The IUPAC name of potassium 2-pentylbenzoate (CID 175429572) is potassium 2-pentylbenzoate.
What is the SMILES notation for potassium 2-pentylbenzoate?
The canonical SMILES for potassium 2-pentylbenzoate is CCCCCc1ccccc1C(=O)[O-].[K+].
What is the InChIKey of potassium 2-pentylbenzoate?
The InChIKey is GKIUYYNPIXLGNP-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16O2.K/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14;/h5-6,8-9H,2-4,7H2,1H3,(H,13,14);/q;+1/p-1.
What are the key properties of potassium 2-pentylbenzoate?
potassium 2-pentylbenzoate has a molecular weight of 230.35 g/mol, XLogP of -1.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-pentylbenzoate is sourced from PubChem (CID 175429572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).