About sodium 2-pentylbenzoate
sodium 2-pentylbenzoate (PubChem CID 23698943) has the molecular formula C12H15NaO2
and a molecular weight of 214.24 g/mol. Its IUPAC name is sodium 2-pentylbenzoate.
Molecular Properties
| Compound Name | sodium 2-pentylbenzoate |
| PubChem CID | 23698943 |
| Molecular Formula | C12H15NaO2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | sodium 2-pentylbenzoate |
| SMILES | CCCCCc1ccccc1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H16O2.Na/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14;/h5-6,8-9H,2-4,7H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | ZTVNCTPQNPIFEP-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-pentylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-pentylbenzoate?
The IUPAC name of sodium 2-pentylbenzoate (CID 23698943) is sodium 2-pentylbenzoate.
What is the SMILES notation for sodium 2-pentylbenzoate?
The canonical SMILES for sodium 2-pentylbenzoate is CCCCCc1ccccc1C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-pentylbenzoate?
The InChIKey is ZTVNCTPQNPIFEP-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16O2.Na/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14;/h5-6,8-9H,2-4,7H2,1H3,(H,13,14);/q;+1/p-1.
What are the key properties of sodium 2-pentylbenzoate?
sodium 2-pentylbenzoate has a molecular weight of 214.24 g/mol, XLogP of -1.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-pentylbenzoate is sourced from PubChem (CID 23698943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).