About zinc bis(2-heptylbenzoate)
zinc bis(2-heptylbenzoate) (PubChem CID 101299904) has the molecular formula C28H38O4Zn
and a molecular weight of 504.00 g/mol. Its IUPAC name is zinc bis(2-heptylbenzoate).
Molecular Properties
| Compound Name | zinc bis(2-heptylbenzoate) |
| PubChem CID | 101299904 |
| Molecular Formula | C28H38O4Zn |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | zinc bis(2-heptylbenzoate) |
| SMILES | CCCCCCCc1ccccc1C(=O)[O-].CCCCCCCc1ccccc1C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C14H20O2.Zn/c2*1-2-3-4-5-6-9-12-10-7-8-11-13(12)14(15)16;/h2*7-8,10-11H,2-6,9H2,1H3,(H,15,16);/q;;+2/p-2 |
| InChIKey | RSNMDBQJFNVAHB-UHFFFAOYSA-L |
| XLogP | 5.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-heptylbenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-heptylbenzoate)?
The IUPAC name of zinc bis(2-heptylbenzoate) (CID 101299904) is zinc bis(2-heptylbenzoate).
What is the SMILES notation for zinc bis(2-heptylbenzoate)?
The canonical SMILES for zinc bis(2-heptylbenzoate) is CCCCCCCc1ccccc1C(=O)[O-].CCCCCCCc1ccccc1C(=O)[O-].[Zn+2].
What is the InChIKey of zinc bis(2-heptylbenzoate)?
The InChIKey is RSNMDBQJFNVAHB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H20O2.Zn/c2*1-2-3-4-5-6-9-12-10-7-8-11-13(12)14(15)16;/h2*7-8,10-11H,2-6,9H2,1H3,(H,15,16);/q;;+2/p-2.
What are the key properties of zinc bis(2-heptylbenzoate)?
zinc bis(2-heptylbenzoate) has a molecular weight of 504.00 g/mol, XLogP of 5.12, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-heptylbenzoate) is sourced from PubChem (CID 101299904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).