About bis(2-butylbenzoate);cadmium(2+)
bis(2-butylbenzoate);cadmium(2+) (PubChem CID 101299924) has the molecular formula C22H26CdO4
and a molecular weight of 466.86 g/mol. Its IUPAC name is bis(2-butylbenzoate);cadmium(2+).
Molecular Properties
| Compound Name | bis(2-butylbenzoate);cadmium(2+) |
| PubChem CID | 101299924 |
| Molecular Formula | C22H26CdO4 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | bis(2-butylbenzoate);cadmium(2+) |
| SMILES | CCCCc1ccccc1C(=O)[O-].CCCCc1ccccc1C(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C11H14O2.Cd/c2*1-2-3-6-9-7-4-5-8-10(9)11(12)13;/h2*4-5,7-8H,2-3,6H2,1H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | WFWHAVOFAHKUEC-UHFFFAOYSA-L |
| XLogP | 2.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-butylbenzoate);cadmium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butylbenzoate);cadmium(2+)?
The IUPAC name of bis(2-butylbenzoate);cadmium(2+) (CID 101299924) is bis(2-butylbenzoate);cadmium(2+).
What is the SMILES notation for bis(2-butylbenzoate);cadmium(2+)?
The canonical SMILES for bis(2-butylbenzoate);cadmium(2+) is CCCCc1ccccc1C(=O)[O-].CCCCc1ccccc1C(=O)[O-].[Cd+2].
What is the InChIKey of bis(2-butylbenzoate);cadmium(2+)?
The InChIKey is WFWHAVOFAHKUEC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H14O2.Cd/c2*1-2-3-6-9-7-4-5-8-10(9)11(12)13;/h2*4-5,7-8H,2-3,6H2,1H3,(H,12,13);/q;;+2/p-2.
What are the key properties of bis(2-butylbenzoate);cadmium(2+)?
bis(2-butylbenzoate);cadmium(2+) has a molecular weight of 466.86 g/mol, XLogP of 2.78, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butylbenzoate);cadmium(2+) is sourced from PubChem (CID 101299924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).