About 3-butylphthalate
3-butylphthalate (PubChem CID 22401953) has the molecular formula C12H12O4-2
and a molecular weight of 220.22 g/mol. Its IUPAC name is 3-butylphthalate.
Molecular Properties
| Compound Name | 3-butylphthalate |
| PubChem CID | 22401953 |
| Molecular Formula | C12H12O4-2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-butylphthalate |
| SMILES | CCCCc1cccc(C(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C12H14O4/c1-2-3-5-8-6-4-7-9(11(13)14)10(8)12(15)16/h4,6-7H,2-3,5H2,1H3,(H,13,14)(H,15,16)/p-2 |
| InChIKey | CVHYRUZKSZTEQX-UHFFFAOYSA-L |
| XLogP | -0.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butylphthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylphthalate?
The IUPAC name of 3-butylphthalate (CID 22401953) is 3-butylphthalate.
What is the SMILES notation for 3-butylphthalate?
The canonical SMILES for 3-butylphthalate is CCCCc1cccc(C(=O)[O-])c1C(=O)[O-].
What is the InChIKey of 3-butylphthalate?
The InChIKey is CVHYRUZKSZTEQX-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H14O4/c1-2-3-5-8-6-4-7-9(11(13)14)10(8)12(15)16/h4,6-7H,2-3,5H2,1H3,(H,13,14)(H,15,16)/p-2.
What are the key properties of 3-butylphthalate?
3-butylphthalate has a molecular weight of 220.22 g/mol, XLogP of -0.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylphthalate is sourced from PubChem (CID 22401953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).