About bis(3-butylphthalate);cobalt
bis(3-butylphthalate);cobalt (PubChem CID 158616915) has the molecular formula C24H24CoO8-4
and a molecular weight of 499.38 g/mol. Its IUPAC name is bis(3-butylphthalate);cobalt.
Molecular Properties
| Compound Name | bis(3-butylphthalate);cobalt |
| PubChem CID | 158616915 |
| Molecular Formula | C24H24CoO8-4 |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | bis(3-butylphthalate);cobalt |
| SMILES | CCCCc1cccc(C(=O)[O-])c1C(=O)[O-].CCCCc1cccc(C(=O)[O-])c1C(=O)[O-].[Co] |
| InChI | InChI=1S/2C12H14O4.Co/c2*1-2-3-5-8-6-4-7-9(11(13)14)10(8)12(15)16;/h2*4,6-7H,2-3,5H2,1H3,(H,13,14)(H,15,16);/p-4 |
| InChIKey | YMKFWQPZNZZXOH-UHFFFAOYSA-J |
| XLogP | -0.49 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(3-butylphthalate);cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-butylphthalate);cobalt?
The IUPAC name of bis(3-butylphthalate);cobalt (CID 158616915) is bis(3-butylphthalate);cobalt.
What is the SMILES notation for bis(3-butylphthalate);cobalt?
The canonical SMILES for bis(3-butylphthalate);cobalt is CCCCc1cccc(C(=O)[O-])c1C(=O)[O-].CCCCc1cccc(C(=O)[O-])c1C(=O)[O-].[Co].
What is the InChIKey of bis(3-butylphthalate);cobalt?
The InChIKey is YMKFWQPZNZZXOH-UHFFFAOYSA-J. The full InChI is InChI=1S/2C12H14O4.Co/c2*1-2-3-5-8-6-4-7-9(11(13)14)10(8)12(15)16;/h2*4,6-7H,2-3,5H2,1H3,(H,13,14)(H,15,16);/p-4.
What are the key properties of bis(3-butylphthalate);cobalt?
bis(3-butylphthalate);cobalt has a molecular weight of 499.38 g/mol, XLogP of -0.49, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-butylphthalate);cobalt is sourced from PubChem (CID 158616915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).