About 3-butylbenzene-1,2-dicarbonyl chloride
3-butylbenzene-1,2-dicarbonyl chloride (PubChem CID 18925831) has the molecular formula C12H12Cl2O2
and a molecular weight of 259.13 g/mol. Its IUPAC name is 3-butylbenzene-1,2-dicarbonyl chloride.
Molecular Properties
| Compound Name | 3-butylbenzene-1,2-dicarbonyl chloride |
| PubChem CID | 18925831 |
| Molecular Formula | C12H12Cl2O2 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 3-butylbenzene-1,2-dicarbonyl chloride |
| SMILES | CCCCc1cccc(C(=O)Cl)c1C(=O)Cl |
| InChI | InChI=1S/C12H12Cl2O2/c1-2-3-5-8-6-4-7-9(11(13)15)10(8)12(14)16/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | CGHDFHJKJRNLAR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-butylbenzene-1,2-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylbenzene-1,2-dicarbonyl chloride?
The IUPAC name of 3-butylbenzene-1,2-dicarbonyl chloride (CID 18925831) is 3-butylbenzene-1,2-dicarbonyl chloride.
What is the SMILES notation for 3-butylbenzene-1,2-dicarbonyl chloride?
The canonical SMILES for 3-butylbenzene-1,2-dicarbonyl chloride is CCCCc1cccc(C(=O)Cl)c1C(=O)Cl.
What is the InChIKey of 3-butylbenzene-1,2-dicarbonyl chloride?
The InChIKey is CGHDFHJKJRNLAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2O2/c1-2-3-5-8-6-4-7-9(11(13)15)10(8)12(14)16/h4,6-7H,2-3,5H2,1H3.
What are the key properties of 3-butylbenzene-1,2-dicarbonyl chloride?
3-butylbenzene-1,2-dicarbonyl chloride has a molecular weight of 259.13 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylbenzene-1,2-dicarbonyl chloride is sourced from PubChem (CID 18925831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).