About 2-heptyl-6-methylbenzoyl chloride
2-heptyl-6-methylbenzoyl chloride (PubChem CID 22919764) has the molecular formula C15H21ClO
and a molecular weight of 252.78 g/mol. Its IUPAC name is 2-heptyl-6-methylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-heptyl-6-methylbenzoyl chloride |
| PubChem CID | 22919764 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-heptyl-6-methylbenzoyl chloride |
| SMILES | CCCCCCCc1cccc(C)c1C(=O)Cl |
| InChI | InChI=1S/C15H21ClO/c1-3-4-5-6-7-10-13-11-8-9-12(2)14(13)15(16)17/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | UHYBZXKKOKZXAU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-6-methylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-6-methylbenzoyl chloride?
The IUPAC name of 2-heptyl-6-methylbenzoyl chloride (CID 22919764) is 2-heptyl-6-methylbenzoyl chloride.
What is the SMILES notation for 2-heptyl-6-methylbenzoyl chloride?
The canonical SMILES for 2-heptyl-6-methylbenzoyl chloride is CCCCCCCc1cccc(C)c1C(=O)Cl.
What is the InChIKey of 2-heptyl-6-methylbenzoyl chloride?
The InChIKey is UHYBZXKKOKZXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO/c1-3-4-5-6-7-10-13-11-8-9-12(2)14(13)15(16)17/h8-9,11H,3-7,10H2,1-2H3.
What are the key properties of 2-heptyl-6-methylbenzoyl chloride?
2-heptyl-6-methylbenzoyl chloride has a molecular weight of 252.78 g/mol, XLogP of 4.89, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-6-methylbenzoyl chloride is sourced from PubChem (CID 22919764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).