About 2-hydroxy-6-octylbenzoic acid
2-hydroxy-6-octylbenzoic acid (PubChem CID 14298684) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-hydroxy-6-octylbenzoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-6-octylbenzoic acid |
| PubChem CID | 14298684 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-hydroxy-6-octylbenzoic acid |
| SMILES | CCCCCCCCc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C15H22O3/c1-2-3-4-5-6-7-9-12-10-8-11-13(16)14(12)15(17)18/h8,10-11,16H,2-7,9H2,1H3,(H,17,18) |
| InChIKey | URXCFPXNCPBEJA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-6-octylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-6-octylbenzoic acid?
The IUPAC name of 2-hydroxy-6-octylbenzoic acid (CID 14298684) is 2-hydroxy-6-octylbenzoic acid.
What is the SMILES notation for 2-hydroxy-6-octylbenzoic acid?
The canonical SMILES for 2-hydroxy-6-octylbenzoic acid is CCCCCCCCc1cccc(O)c1C(=O)O.
What is the InChIKey of 2-hydroxy-6-octylbenzoic acid?
The InChIKey is URXCFPXNCPBEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-2-3-4-5-6-7-9-12-10-8-11-13(16)14(12)15(17)18/h8,10-11,16H,2-7,9H2,1H3,(H,17,18).
What are the key properties of 2-hydroxy-6-octylbenzoic acid?
2-hydroxy-6-octylbenzoic acid has a molecular weight of 250.34 g/mol, XLogP of 3.99, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-octylbenzoic acid is sourced from PubChem (CID 14298684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).