2-hydroxy-6-octylbenzoic acid

C15H22O3 — CID 14298684

IUPAC2-hydroxy-6-octylbenzoic acid
SMILESCCCCCCCCc1cccc(O)c1C(=O)O
InChIInChI=1S/C15H22O3/c1-2-3-4-5-6-7-9-12-10-8-11-13(16)14(12)15(17)18/h8,10-11,16H,2-7,9H2,1H3,(H,17,18)
InChIKeyURXCFPXNCPBEJA-UHFFFAOYSA-N
MW250.34 g/mol
LogP3.99
Rot. Bonds8

About 2-hydroxy-6-octylbenzoic acid

2-hydroxy-6-octylbenzoic acid (PubChem CID 14298684) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-hydroxy-6-octylbenzoic acid.

Molecular Properties

Compound Name2-hydroxy-6-octylbenzoic acid
PubChem CID14298684
Molecular FormulaC15H22O3
Molecular Weight250.34 g/mol
Exact Mass250.16
IUPAC Name2-hydroxy-6-octylbenzoic acid
SMILESCCCCCCCCc1cccc(O)c1C(=O)O
InChIInChI=1S/C15H22O3/c1-2-3-4-5-6-7-9-12-10-8-11-13(16)14(12)15(17)18/h8,10-11,16H,2-7,9H2,1H3,(H,17,18)
InChIKeyURXCFPXNCPBEJA-UHFFFAOYSA-N
XLogP3.99
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.34
LogP ≤ 53.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-hydroxy-6-octylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-6-octylbenzoic acid?
The IUPAC name of 2-hydroxy-6-octylbenzoic acid (CID 14298684) is 2-hydroxy-6-octylbenzoic acid.
What is the SMILES notation for 2-hydroxy-6-octylbenzoic acid?
The canonical SMILES for 2-hydroxy-6-octylbenzoic acid is CCCCCCCCc1cccc(O)c1C(=O)O.
What is the InChIKey of 2-hydroxy-6-octylbenzoic acid?
The InChIKey is URXCFPXNCPBEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-2-3-4-5-6-7-9-12-10-8-11-13(16)14(12)15(17)18/h8,10-11,16H,2-7,9H2,1H3,(H,17,18).
What are the key properties of 2-hydroxy-6-octylbenzoic acid?
2-hydroxy-6-octylbenzoic acid has a molecular weight of 250.34 g/mol, XLogP of 3.99, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-octylbenzoic acid is sourced from PubChem (CID 14298684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).