C23H40O4 — CID 67779350
acetic acid;3-pentadecylbenzene-1,2-diol (PubChem CID 67779350) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is acetic acid;3-pentadecylbenzene-1,2-diol.
| Compound Name | acetic acid;3-pentadecylbenzene-1,2-diol |
|---|---|
| PubChem CID | 67779350 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | acetic acid;3-pentadecylbenzene-1,2-diol |
| SMILES | CC(=O)O.CCCCCCCCCCCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C21H36O2.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23;1-2(3)4/h15,17-18,22-23H,2-14,16H2,1H3;1H3,(H,3,4) |
| InChIKey | AQBQVMUSHPHAKR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|