C16H26O3 — CID 154435441
3-(6-butoxyhexyl)benzene-1,2-diol (PubChem CID 154435441) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-(6-butoxyhexyl)benzene-1,2-diol.
| Compound Name | 3-(6-butoxyhexyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 154435441 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 3-(6-butoxyhexyl)benzene-1,2-diol |
| SMILES | CCCCOCCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C16H26O3/c1-2-3-12-19-13-7-5-4-6-9-14-10-8-11-15(17)16(14)18/h8,10-11,17-18H,2-7,9,12-13H2,1H3 |
| InChIKey | FQTLAYFGBPDRRD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|