C21H32O2 — CID 6446932
3-[(7E,10E)-pentadeca-7,10-dienyl]benzene-1,2-diol (PubChem CID 6446932) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 3-[(7E,10E)-pentadeca-7,10-dienyl]benzene-1,2-diol.
| Compound Name | 3-[(7E,10E)-pentadeca-7,10-dienyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 6446932 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 3-[(7E,10E)-pentadeca-7,10-dienyl]benzene-1,2-diol |
| SMILES | CCCC/C=C/C/C=C/CCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C21H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23/h5-6,8-9,15,17-18,22-23H,2-4,7,10-14,16H2,1H3/b6-5+,9-8+ |
| InChIKey | ADQRHHAWQDNVQI-HHWLVVFRSA-N |
| XLogP | 6.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|