C63H96O6 — CID 5478165
3-[(8E,11E)-pentadeca-8,11-dienyl]benzene-1,2-diol;3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene-1,2-diol;3-[(E)-pentadec-8-enyl]benzene-1,2-diol (PubChem CID 5478165) has the molecular formula C63H96O6 and a molecular weight of 949.45 g/mol. Its IUPAC name is 3-[(8E,11E)-pentadeca-8,11-dienyl]benzene-1,2-diol;3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene-1,2-diol;3-[(E)-pentadec-8-enyl]benzene-1,2-diol.
| Compound Name | 3-[(8E,11E)-pentadeca-8,11-dienyl]benzene-1,2-diol;3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene-1,2-diol;3-[(E)-pentadec-8-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 5478165 |
| Molecular Formula | C63H96O6 |
| Molecular Weight | 949.45 g/mol |
| Exact Mass | 948.72 |
| IUPAC Name | 3-[(8E,11E)-pentadeca-8,11-dienyl]benzene-1,2-diol;3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene-1,2-diol;3-[(E)-pentadec-8-enyl]benzene-1,2-diol |
| SMILES | C=CC/C=C/C/C=C/CCCCCCCc1cccc(O)c1O.CCC/C=C/C/C=C/CCCCCCCc1cccc(O)c1O.CCCCCC/C=C/CCCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C21H34O2.C21H32O2.C21H30O2/c3*1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23/h7-8,15,17-18,22-23H,2-6,9-14,16H2,1H3;4-5,7-8,15,17-18,22-23H,2-3,6,9-14,16H2,1H3;2,4-5,7-8,15,17-18,22-23H,1,3,6,9-14,16H2/b8-7+;2*5-4+,8-7+ |
| InChIKey | MMJLLUHNBNXQDL-XSBYHUFWSA-N |
| XLogP | 18.85 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.45 |
| LogP ≤ 5 | 18.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|