C18H30O3 — CID 154435375
3-(5-heptoxypentyl)benzene-1,2-diol (PubChem CID 154435375) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 3-(5-heptoxypentyl)benzene-1,2-diol.
| Compound Name | 3-(5-heptoxypentyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 154435375 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 3-(5-heptoxypentyl)benzene-1,2-diol |
| SMILES | CCCCCCCOCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-8-14-21-15-9-6-7-11-16-12-10-13-17(19)18(16)20/h10,12-13,19-20H,2-9,11,14-15H2,1H3 |
| InChIKey | MNJVQQZFZJOTBX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|