C22H36O5 — CID 69498679
6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid (PubChem CID 69498679) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid.
| Compound Name | 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 69498679 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid |
| SMILES | CCCCCCOCCCCCCCCCc1ccc(O)c(O)c1C(=O)O |
| InChI | InChI=1S/C22H36O5/c1-2-3-4-11-16-27-17-12-9-7-5-6-8-10-13-18-14-15-19(23)21(24)20(18)22(25)26/h14-15,23-24H,2-13,16-17H2,1H3,(H,25,26) |
| InChIKey | QLTVNLKJZLCNDS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|