6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid

C22H36O5 — CID 69498679

IUPAC6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid
SMILESCCCCCCOCCCCCCCCCc1ccc(O)c(O)c1C(=O)O
InChIInChI=1S/C22H36O5/c1-2-3-4-11-16-27-17-12-9-7-5-6-8-10-13-18-14-15-19(23)21(24)20(18)22(25)26/h14-15,23-24H,2-13,16-17H2,1H3,(H,25,26)
InChIKeyQLTVNLKJZLCNDS-UHFFFAOYSA-N
MW380.53 g/mol
LogP5.67
Rot. Bonds16

About 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid

6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid (PubChem CID 69498679) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid.

Molecular Properties

Compound Name6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid
PubChem CID69498679
Molecular FormulaC22H36O5
Molecular Weight380.53 g/mol
Exact Mass380.26
IUPAC Name6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid
SMILESCCCCCCOCCCCCCCCCc1ccc(O)c(O)c1C(=O)O
InChIInChI=1S/C22H36O5/c1-2-3-4-11-16-27-17-12-9-7-5-6-8-10-13-18-14-15-19(23)21(24)20(18)22(25)26/h14-15,23-24H,2-13,16-17H2,1H3,(H,25,26)
InChIKeyQLTVNLKJZLCNDS-UHFFFAOYSA-N
XLogP5.67
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds16
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500380.53
LogP ≤ 55.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid?
The IUPAC name of 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid (CID 69498679) is 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid.
What is the SMILES notation for 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid?
The canonical SMILES for 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid is CCCCCCOCCCCCCCCCc1ccc(O)c(O)c1C(=O)O.
What is the InChIKey of 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid?
The InChIKey is QLTVNLKJZLCNDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O5/c1-2-3-4-11-16-27-17-12-9-7-5-6-8-10-13-18-14-15-19(23)21(24)20(18)22(25)26/h14-15,23-24H,2-13,16-17H2,1H3,(H,25,26).
What are the key properties of 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid?
6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid has a molecular weight of 380.53 g/mol, XLogP of 5.67, 16 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(9-hexoxynonyl)-2,3-dihydroxybenzoic acid is sourced from PubChem (CID 69498679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).