C24H40O5 — CID 87860397
2,3-dihydroxy-5-nonyl-6-octoxybenzoic acid (PubChem CID 87860397) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 2,3-dihydroxy-5-nonyl-6-octoxybenzoic acid.
| Compound Name | 2,3-dihydroxy-5-nonyl-6-octoxybenzoic acid |
|---|---|
| PubChem CID | 87860397 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 2,3-dihydroxy-5-nonyl-6-octoxybenzoic acid |
| SMILES | CCCCCCCCCc1cc(O)c(O)c(C(=O)O)c1OCCCCCCCC |
| InChI | InChI=1S/C24H40O5/c1-3-5-7-9-11-12-14-16-19-18-20(25)22(26)21(24(27)28)23(19)29-17-15-13-10-8-6-4-2/h18,25-26H,3-17H2,1-2H3,(H,27,28) |
| InChIKey | AJSVIIFKCXCYBO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|