C39H70O7 — CID 87860844
2-hydroxy-4,5,6-tri(nonoxy)-3-pentoxybenzoic acid (PubChem CID 87860844) has the molecular formula C39H70O7 and a molecular weight of 650.98 g/mol. Its IUPAC name is 2-hydroxy-4,5,6-tri(nonoxy)-3-pentoxybenzoic acid.
| Compound Name | 2-hydroxy-4,5,6-tri(nonoxy)-3-pentoxybenzoic acid |
|---|---|
| PubChem CID | 87860844 |
| Molecular Formula | C39H70O7 |
| Molecular Weight | 650.98 g/mol |
| Exact Mass | 650.51 |
| IUPAC Name | 2-hydroxy-4,5,6-tri(nonoxy)-3-pentoxybenzoic acid |
| SMILES | CCCCCCCCCOc1c(OCCCCC)c(O)c(C(=O)O)c(OCCCCCCCCC)c1OCCCCCCCCC |
| InChI | InChI=1S/C39H70O7/c1-5-9-13-16-19-22-26-30-43-35-33(39(41)42)34(40)36(44-29-25-12-8-4)38(46-32-28-24-21-18-15-11-7-3)37(35)45-31-27-23-20-17-14-10-6-2/h40H,5-32H2,1-4H3,(H,41,42) |
| InChIKey | ARKMVVMUFWNSQW-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.98 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|