C16H21Br3O4 — CID 87860190
2,3,4-tribromo-6-hydroxy-5-nonoxybenzoic acid (PubChem CID 87860190) has the molecular formula C16H21Br3O4 and a molecular weight of 517.05 g/mol. Its IUPAC name is 2,3,4-tribromo-6-hydroxy-5-nonoxybenzoic acid.
| Compound Name | 2,3,4-tribromo-6-hydroxy-5-nonoxybenzoic acid |
|---|---|
| PubChem CID | 87860190 |
| Molecular Formula | C16H21Br3O4 |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 513.90 |
| IUPAC Name | 2,3,4-tribromo-6-hydroxy-5-nonoxybenzoic acid |
| SMILES | CCCCCCCCCOc1c(O)c(C(=O)O)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C16H21Br3O4/c1-2-3-4-5-6-7-8-9-23-15-13(19)12(18)11(17)10(14(15)20)16(21)22/h20H,2-9H2,1H3,(H,21,22) |
| InChIKey | CIVQCANTJFPNOK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|