C35H62O6 — CID 87860667
2-hydroxy-3-nonoxy-4-nonyl-5,6-dipentoxybenzoic acid (PubChem CID 87860667) has the molecular formula C35H62O6 and a molecular weight of 578.88 g/mol. Its IUPAC name is 2-hydroxy-3-nonoxy-4-nonyl-5,6-dipentoxybenzoic acid.
| Compound Name | 2-hydroxy-3-nonoxy-4-nonyl-5,6-dipentoxybenzoic acid |
|---|---|
| PubChem CID | 87860667 |
| Molecular Formula | C35H62O6 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.45 |
| IUPAC Name | 2-hydroxy-3-nonoxy-4-nonyl-5,6-dipentoxybenzoic acid |
| SMILES | CCCCCCCCCOc1c(O)c(C(=O)O)c(OCCCCC)c(OCCCCC)c1CCCCCCCCC |
| InChI | InChI=1S/C35H62O6/c1-5-9-13-15-17-19-21-25-29-32(39-28-24-20-18-16-14-10-6-2)31(36)30(35(37)38)34(41-27-23-12-8-4)33(29)40-26-22-11-7-3/h36H,5-28H2,1-4H3,(H,37,38) |
| InChIKey | FGZXXEOVADUEMI-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|