C25H41NO6 — CID 87860068
3-hexoxy-4,5-dihexyl-2-hydroxy-6-nitrobenzoic acid (PubChem CID 87860068) has the molecular formula C25H41NO6 and a molecular weight of 451.60 g/mol. Its IUPAC name is 3-hexoxy-4,5-dihexyl-2-hydroxy-6-nitrobenzoic acid.
| Compound Name | 3-hexoxy-4,5-dihexyl-2-hydroxy-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 87860068 |
| Molecular Formula | C25H41NO6 |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 3-hexoxy-4,5-dihexyl-2-hydroxy-6-nitrobenzoic acid |
| SMILES | CCCCCCOc1c(O)c(C(=O)O)c([N+](=O)[O-])c(CCCCCC)c1CCCCCC |
| InChI | InChI=1S/C25H41NO6/c1-4-7-10-13-16-19-20(17-14-11-8-5-2)24(32-18-15-12-9-6-3)23(27)21(25(28)29)22(19)26(30)31/h27H,4-18H2,1-3H3,(H,28,29) |
| InChIKey | LUOWDLPQKQYIDH-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|