C30H52O5 — CID 87859114
4,5-didecyl-2,3-dihydroxy-6-propoxybenzoic acid (PubChem CID 87859114) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is 4,5-didecyl-2,3-dihydroxy-6-propoxybenzoic acid.
| Compound Name | 4,5-didecyl-2,3-dihydroxy-6-propoxybenzoic acid |
|---|---|
| PubChem CID | 87859114 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | 4,5-didecyl-2,3-dihydroxy-6-propoxybenzoic acid |
| SMILES | CCCCCCCCCCc1c(O)c(O)c(C(=O)O)c(OCCC)c1CCCCCCCCCC |
| InChI | InChI=1S/C30H52O5/c1-4-7-9-11-13-15-17-19-21-24-25(22-20-18-16-14-12-10-8-5-2)29(35-23-6-3)26(30(33)34)28(32)27(24)31/h31-32H,4-23H2,1-3H3,(H,33,34) |
| InChIKey | WCEWJPKSCSDLRP-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|