C38H68O5 — CID 87860766
[2-butoxy-6-hydroxy-3,4,5-tri(nonyl)phenyl] hydrogen carbonate (PubChem CID 87860766) has the molecular formula C38H68O5 and a molecular weight of 604.96 g/mol. Its IUPAC name is [2-butoxy-6-hydroxy-3,4,5-tri(nonyl)phenyl] hydrogen carbonate.
| Compound Name | [2-butoxy-6-hydroxy-3,4,5-tri(nonyl)phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 87860766 |
| Molecular Formula | C38H68O5 |
| Molecular Weight | 604.96 g/mol |
| Exact Mass | 604.51 |
| IUPAC Name | [2-butoxy-6-hydroxy-3,4,5-tri(nonyl)phenyl] hydrogen carbonate |
| SMILES | CCCCCCCCCc1c(O)c(OC(=O)O)c(OCCCC)c(CCCCCCCCC)c1CCCCCCCCC |
| InChI | InChI=1S/C38H68O5/c1-5-9-13-16-19-22-25-28-32-33(29-26-23-20-17-14-10-6-2)35(39)37(43-38(40)41)36(42-31-12-8-4)34(32)30-27-24-21-18-15-11-7-3/h39H,5-31H2,1-4H3,(H,40,41) |
| InChIKey | REOAQLDPHLMJTD-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.96 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|