C23H38O5 — CID 87859329
(2-butoxy-3,4,5-tributyl-6-hydroxyphenyl) hydrogen carbonate (PubChem CID 87859329) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is (2-butoxy-3,4,5-tributyl-6-hydroxyphenyl) hydrogen carbonate.
| Compound Name | (2-butoxy-3,4,5-tributyl-6-hydroxyphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87859329 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (2-butoxy-3,4,5-tributyl-6-hydroxyphenyl) hydrogen carbonate |
| SMILES | CCCCOc1c(CCCC)c(CCCC)c(CCCC)c(O)c1OC(=O)O |
| InChI | InChI=1S/C23H38O5/c1-5-9-13-17-18(14-10-6-2)20(24)22(28-23(25)26)21(27-16-12-8-4)19(17)15-11-7-3/h24H,5-16H2,1-4H3,(H,25,26) |
| InChIKey | CERZVDVVGGZKTK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|