C28H50O4 — CID 154435286
3,4-dibutyl-5,6-diheptoxybenzene-1,2-diol (PubChem CID 154435286) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is 3,4-dibutyl-5,6-diheptoxybenzene-1,2-diol.
| Compound Name | 3,4-dibutyl-5,6-diheptoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 154435286 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | 3,4-dibutyl-5,6-diheptoxybenzene-1,2-diol |
| SMILES | CCCCCCCOc1c(O)c(O)c(CCCC)c(CCCC)c1OCCCCCCC |
| InChI | InChI=1S/C28H50O4/c1-5-9-13-15-17-21-31-27-24(20-12-8-4)23(19-11-7-3)25(29)26(30)28(27)32-22-18-16-14-10-6-2/h29-30H,5-22H2,1-4H3 |
| InChIKey | FCWPDZUWVZEANZ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|