C33H60O5 — CID 154435459
3,4,5-triheptoxy-6-hexylbenzene-1,2-diol (PubChem CID 154435459) has the molecular formula C33H60O5 and a molecular weight of 536.84 g/mol. Its IUPAC name is 3,4,5-triheptoxy-6-hexylbenzene-1,2-diol.
| Compound Name | 3,4,5-triheptoxy-6-hexylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435459 |
| Molecular Formula | C33H60O5 |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 536.44 |
| IUPAC Name | 3,4,5-triheptoxy-6-hexylbenzene-1,2-diol |
| SMILES | CCCCCCCOc1c(O)c(O)c(CCCCCC)c(OCCCCCCC)c1OCCCCCCC |
| InChI | InChI=1S/C33H60O5/c1-5-9-13-17-21-25-36-31-28(24-20-16-12-8-4)29(34)30(35)32(37-26-22-18-14-10-6-2)33(31)38-27-23-19-15-11-7-3/h34-35H,5-27H2,1-4H3 |
| InChIKey | YDPBWGZHXOMHJT-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|