C41H74O6 — CID 87860541
[2-hydroxy-5,6-di(nonyl)-3,4-dioctoxyphenyl] hydrogen carbonate (PubChem CID 87860541) has the molecular formula C41H74O6 and a molecular weight of 663.04 g/mol. Its IUPAC name is [2-hydroxy-5,6-di(nonyl)-3,4-dioctoxyphenyl] hydrogen carbonate.
| Compound Name | [2-hydroxy-5,6-di(nonyl)-3,4-dioctoxyphenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 87860541 |
| Molecular Formula | C41H74O6 |
| Molecular Weight | 663.04 g/mol |
| Exact Mass | 662.55 |
| IUPAC Name | [2-hydroxy-5,6-di(nonyl)-3,4-dioctoxyphenyl] hydrogen carbonate |
| SMILES | CCCCCCCCCc1c(CCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c(O)c1OC(=O)O |
| InChI | InChI=1S/C41H74O6/c1-5-9-13-17-21-23-27-31-35-36(32-28-24-22-18-14-10-6-2)39(45-33-29-25-19-15-11-7-3)40(37(42)38(35)47-41(43)44)46-34-30-26-20-16-12-8-4/h42H,5-34H2,1-4H3,(H,43,44) |
| InChIKey | XXUDHTOGJHSBDL-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.04 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|