C35H62O7 — CID 87859293
[2-hydroxy-6-methyl-3,4,5-tri(nonoxy)phenyl] hydrogen carbonate (PubChem CID 87859293) has the molecular formula C35H62O7 and a molecular weight of 594.87 g/mol. Its IUPAC name is [2-hydroxy-6-methyl-3,4,5-tri(nonoxy)phenyl] hydrogen carbonate.
| Compound Name | [2-hydroxy-6-methyl-3,4,5-tri(nonoxy)phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 87859293 |
| Molecular Formula | C35H62O7 |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.45 |
| IUPAC Name | [2-hydroxy-6-methyl-3,4,5-tri(nonoxy)phenyl] hydrogen carbonate |
| SMILES | CCCCCCCCCOc1c(C)c(OC(=O)O)c(O)c(OCCCCCCCCC)c1OCCCCCCCCC |
| InChI | InChI=1S/C35H62O7/c1-5-8-11-14-17-20-23-26-39-32-29(4)31(42-35(37)38)30(36)33(40-27-24-21-18-15-12-9-6-2)34(32)41-28-25-22-19-16-13-10-7-3/h36H,5-28H2,1-4H3,(H,37,38) |
| InChIKey | XOYSVHXJKYOWLT-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|