(2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate

C40H72O7 — CID 87860771

IUPAC(2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate
SMILESCCCCCCCCCc1c(OC(=O)O)c(O)c(OCCCCCCCC)c(OCCCCCCCC)c1OCCCCCCCC
InChIInChI=1S/C40H72O7/c1-5-9-13-17-21-22-26-30-34-36(47-40(42)43)35(41)38(45-32-28-24-19-15-11-7-3)39(46-33-29-25-20-16-12-8-4)37(34)44-31-27-23-18-14-10-6-2/h41H,5-33H2,1-4H3,(H,42,43)
InChIKeyPZIUGFKESDYEMJ-UHFFFAOYSA-N
MW665.01 g/mol
LogP12.96
Rot. Bonds33

About (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate

(2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate (PubChem CID 87860771) has the molecular formula C40H72O7 and a molecular weight of 665.01 g/mol. Its IUPAC name is (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate.

Molecular Properties

Compound Name(2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate
PubChem CID87860771
Molecular FormulaC40H72O7
Molecular Weight665.01 g/mol
Exact Mass664.53
IUPAC Name(2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate
SMILESCCCCCCCCCc1c(OC(=O)O)c(O)c(OCCCCCCCC)c(OCCCCCCCC)c1OCCCCCCCC
InChIInChI=1S/C40H72O7/c1-5-9-13-17-21-22-26-30-34-36(47-40(42)43)35(41)38(45-32-28-24-19-15-11-7-3)39(46-33-29-25-20-16-12-8-4)37(34)44-31-27-23-18-14-10-6-2/h41H,5-33H2,1-4H3,(H,42,43)
InChIKeyPZIUGFKESDYEMJ-UHFFFAOYSA-N
XLogP12.96
TPSA94.45 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds33
Heavy Atoms47
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500665.01
LogP ≤ 512.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate?
The IUPAC name of (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate (CID 87860771) is (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate.
What is the SMILES notation for (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate?
The canonical SMILES for (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate is CCCCCCCCCc1c(OC(=O)O)c(O)c(OCCCCCCCC)c(OCCCCCCCC)c1OCCCCCCCC.
What is the InChIKey of (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate?
The InChIKey is PZIUGFKESDYEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H72O7/c1-5-9-13-17-21-22-26-30-34-36(47-40(42)43)35(41)38(45-32-28-24-19-15-11-7-3)39(46-33-29-25-20-16-12-8-4)37(34)44-31-27-23-18-14-10-6-2/h41H,5-33H2,1-4H3,(H,42,43).
What are the key properties of (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate?
(2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate has a molecular weight of 665.01 g/mol, XLogP of 12.96, 33 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate is sourced from PubChem (CID 87860771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).