C40H72O7 — CID 87860771
(2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate (PubChem CID 87860771) has the molecular formula C40H72O7 and a molecular weight of 665.01 g/mol. Its IUPAC name is (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate.
| Compound Name | (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87860771 |
| Molecular Formula | C40H72O7 |
| Molecular Weight | 665.01 g/mol |
| Exact Mass | 664.53 |
| IUPAC Name | (2-hydroxy-6-nonyl-3,4,5-trioctoxyphenyl) hydrogen carbonate |
| SMILES | CCCCCCCCCc1c(OC(=O)O)c(O)c(OCCCCCCCC)c(OCCCCCCCC)c1OCCCCCCCC |
| InChI | InChI=1S/C40H72O7/c1-5-9-13-17-21-22-26-30-34-36(47-40(42)43)35(41)38(45-32-28-24-19-15-11-7-3)39(46-33-29-25-20-16-12-8-4)37(34)44-31-27-23-18-14-10-6-2/h41H,5-33H2,1-4H3,(H,42,43) |
| InChIKey | PZIUGFKESDYEMJ-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.01 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|