C33H58O6 — CID 87859438
(2-hydroxy-5,6-dioctyl-3,4-dipentoxyphenyl) hydrogen carbonate (PubChem CID 87859438) has the molecular formula C33H58O6 and a molecular weight of 550.82 g/mol. Its IUPAC name is (2-hydroxy-5,6-dioctyl-3,4-dipentoxyphenyl) hydrogen carbonate.
| Compound Name | (2-hydroxy-5,6-dioctyl-3,4-dipentoxyphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87859438 |
| Molecular Formula | C33H58O6 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.42 |
| IUPAC Name | (2-hydroxy-5,6-dioctyl-3,4-dipentoxyphenyl) hydrogen carbonate |
| SMILES | CCCCCCCCc1c(CCCCCCCC)c(OCCCCC)c(OCCCCC)c(O)c1OC(=O)O |
| InChI | InChI=1S/C33H58O6/c1-5-9-13-15-17-19-23-27-28(24-20-18-16-14-10-6-2)31(37-25-21-11-7-3)32(38-26-22-12-8-4)29(34)30(27)39-33(35)36/h34H,5-26H2,1-4H3,(H,35,36) |
| InChIKey | SKOWEONVBHGCJA-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|