C27H46O6 — CID 87860048
(2,3-diethoxy-6-hydroxy-4,5-dioctylphenyl) hydrogen carbonate (PubChem CID 87860048) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol. Its IUPAC name is (2,3-diethoxy-6-hydroxy-4,5-dioctylphenyl) hydrogen carbonate.
| Compound Name | (2,3-diethoxy-6-hydroxy-4,5-dioctylphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87860048 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | (2,3-diethoxy-6-hydroxy-4,5-dioctylphenyl) hydrogen carbonate |
| SMILES | CCCCCCCCc1c(O)c(OC(=O)O)c(OCC)c(OCC)c1CCCCCCCC |
| InChI | InChI=1S/C27H46O6/c1-5-9-11-13-15-17-19-21-22(20-18-16-14-12-10-6-2)24(31-7-3)26(32-8-4)25(23(21)28)33-27(29)30/h28H,5-20H2,1-4H3,(H,29,30) |
| InChIKey | WJSNUZPKXYZMPI-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|