C16H24O7 — CID 87860580
(3,4,5-triethoxy-2-hydroxy-6-propylphenyl) hydrogen carbonate (PubChem CID 87860580) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is (3,4,5-triethoxy-2-hydroxy-6-propylphenyl) hydrogen carbonate.
| Compound Name | (3,4,5-triethoxy-2-hydroxy-6-propylphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87860580 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3,4,5-triethoxy-2-hydroxy-6-propylphenyl) hydrogen carbonate |
| SMILES | CCCc1c(OC(=O)O)c(O)c(OCC)c(OCC)c1OCC |
| InChI | InChI=1S/C16H24O7/c1-5-9-10-12(23-16(18)19)11(17)14(21-7-3)15(22-8-4)13(10)20-6-2/h17H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | WFEQZRALNKJUFG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|