C31H54O6 — CID 87860834
(2,3-dibutyl-6-hydroxy-4,5-dioctoxyphenyl) hydrogen carbonate (PubChem CID 87860834) has the molecular formula C31H54O6 and a molecular weight of 522.77 g/mol. Its IUPAC name is (2,3-dibutyl-6-hydroxy-4,5-dioctoxyphenyl) hydrogen carbonate.
| Compound Name | (2,3-dibutyl-6-hydroxy-4,5-dioctoxyphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87860834 |
| Molecular Formula | C31H54O6 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | (2,3-dibutyl-6-hydroxy-4,5-dioctoxyphenyl) hydrogen carbonate |
| SMILES | CCCCCCCCOc1c(O)c(OC(=O)O)c(CCCC)c(CCCC)c1OCCCCCCCC |
| InChI | InChI=1S/C31H54O6/c1-5-9-13-15-17-19-23-35-29-26(22-12-8-4)25(21-11-7-3)28(37-31(33)34)27(32)30(29)36-24-20-18-16-14-10-6-2/h32H,5-24H2,1-4H3,(H,33,34) |
| InChIKey | JGAPUVURDZRGNT-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|