C21H32I2O4 — CID 87859597
(3,4-diheptyl-2-hydroxy-5,6-diiodophenyl) hydrogen carbonate (PubChem CID 87859597) has the molecular formula C21H32I2O4 and a molecular weight of 602.29 g/mol. Its IUPAC name is (3,4-diheptyl-2-hydroxy-5,6-diiodophenyl) hydrogen carbonate.
| Compound Name | (3,4-diheptyl-2-hydroxy-5,6-diiodophenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87859597 |
| Molecular Formula | C21H32I2O4 |
| Molecular Weight | 602.29 g/mol |
| Exact Mass | 602.04 |
| IUPAC Name | (3,4-diheptyl-2-hydroxy-5,6-diiodophenyl) hydrogen carbonate |
| SMILES | CCCCCCCc1c(O)c(OC(=O)O)c(I)c(I)c1CCCCCCC |
| InChI | InChI=1S/C21H32I2O4/c1-3-5-7-9-11-13-15-16(14-12-10-8-6-4-2)19(24)20(27-21(25)26)18(23)17(15)22/h24H,3-14H2,1-2H3,(H,25,26) |
| InChIKey | YBJVJYMWWUNOMU-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.29 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|