C13H16I2O4 — CID 87859227
2-hexyl-5,6-dihydroxy-3,4-diiodobenzoic acid (PubChem CID 87859227) has the molecular formula C13H16I2O4 and a molecular weight of 490.08 g/mol. Its IUPAC name is 2-hexyl-5,6-dihydroxy-3,4-diiodobenzoic acid.
| Compound Name | 2-hexyl-5,6-dihydroxy-3,4-diiodobenzoic acid |
|---|---|
| PubChem CID | 87859227 |
| Molecular Formula | C13H16I2O4 |
| Molecular Weight | 490.08 g/mol |
| Exact Mass | 489.91 |
| IUPAC Name | 2-hexyl-5,6-dihydroxy-3,4-diiodobenzoic acid |
| SMILES | CCCCCCc1c(I)c(I)c(O)c(O)c1C(=O)O |
| InChI | InChI=1S/C13H16I2O4/c1-2-3-4-5-6-7-8(13(18)19)11(16)12(17)10(15)9(7)14/h16-17H,2-6H2,1H3,(H,18,19) |
| InChIKey | PRNJIAGGRBYGPS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.08 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|