3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid

C12H14Cl2O4 — CID 606098

IUPAC3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid
SMILESCCCCCc1c(Cl)c(O)c(Cl)c(O)c1C(=O)O
InChIInChI=1S/C12H14Cl2O4/c1-2-3-4-5-6-7(12(17)18)10(15)9(14)11(16)8(6)13/h15-16H,2-5H2,1H3,(H,17,18)
InChIKeyNFASENGEDPDADX-UHFFFAOYSA-N
MW293.15 g/mol
LogP3.84
Rot. Bonds5

About 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid

3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid (PubChem CID 606098) has the molecular formula C12H14Cl2O4 and a molecular weight of 293.15 g/mol. Its IUPAC name is 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid.

Molecular Properties

Compound Name3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid
PubChem CID606098
Molecular FormulaC12H14Cl2O4
Molecular Weight293.15 g/mol
Exact Mass292.03
IUPAC Name3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid
SMILESCCCCCc1c(Cl)c(O)c(Cl)c(O)c1C(=O)O
InChIInChI=1S/C12H14Cl2O4/c1-2-3-4-5-6-7(12(17)18)10(15)9(14)11(16)8(6)13/h15-16H,2-5H2,1H3,(H,17,18)
InChIKeyNFASENGEDPDADX-UHFFFAOYSA-N
XLogP3.84
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.15
LogP ≤ 53.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4,5-dichloro-2,3-dihydroxy-6-octylbenzoic acid
CID 87859403
4-(3,5-dichloro-2,4-dihydroxy-6-pentylbenzoyl)oxy-2-methoxy-6-pentylbenzoic acid
CID 602882
2,3-dihydroxy-4-iodo-5,6-dipentylbenzoic acid
CID 87859238
2-hexyl-5,6-dihydroxy-3,4-diiodobenzoic acid
CID 87859227
2,3-dihydroxy-5,6-dioctylbenzoic acid
CID 87859104
chloro 4-chloro-2,3-dihydroxy-5,6-dioctylbenzoate
CID 87859573
(3-hydroxy-4-methoxycarbonyl-5-pentylphenyl) 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoate
CID 162844945
2-heptyl-3,4-dihexoxy-5,6-dihydroxybenzoic acid
CID 87860140
4,5-dihexoxy-2,3-dihydroxy-6-nonylbenzoic acid
CID 87859542
3,4-didecoxy-2-heptyl-5,6-dihydroxybenzoic acid
CID 87859692
2-butyl-5,6-dihydroxy-3,4-diiodobenzoic acid
CID 87859857
5-ethylperoxy-2,3,4-triheptyl-6-hydroxybenzoic acid
CID 87860179

Frequently Asked Questions

What is the IUPAC name of 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid?
The IUPAC name of 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid (CID 606098) is 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid.
What is the SMILES notation for 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid?
The canonical SMILES for 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid is CCCCCc1c(Cl)c(O)c(Cl)c(O)c1C(=O)O.
What is the InChIKey of 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid?
The InChIKey is NFASENGEDPDADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2O4/c1-2-3-4-5-6-7(12(17)18)10(15)9(14)11(16)8(6)13/h15-16H,2-5H2,1H3,(H,17,18).
What are the key properties of 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid?
3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid has a molecular weight of 293.15 g/mol, XLogP of 3.84, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2,4-dihydroxy-6-pentylbenzoic acid is sourced from PubChem (CID 606098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).