C23H38O4 — CID 87859104
2,3-dihydroxy-5,6-dioctylbenzoic acid (PubChem CID 87859104) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 2,3-dihydroxy-5,6-dioctylbenzoic acid.
| Compound Name | 2,3-dihydroxy-5,6-dioctylbenzoic acid |
|---|---|
| PubChem CID | 87859104 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 2,3-dihydroxy-5,6-dioctylbenzoic acid |
| SMILES | CCCCCCCCc1cc(O)c(O)c(C(=O)O)c1CCCCCCCC |
| InChI | InChI=1S/C23H38O4/c1-3-5-7-9-11-13-15-18-17-20(24)22(25)21(23(26)27)19(18)16-14-12-10-8-6-4-2/h17,24-25H,3-16H2,1-2H3,(H,26,27) |
| InChIKey | VUPVIOMMMPYCRH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|