C20H34O2 — CID 87876480
4-butyl-3,5-dipentylbenzene-1,2-diol (PubChem CID 87876480) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 4-butyl-3,5-dipentylbenzene-1,2-diol.
| Compound Name | 4-butyl-3,5-dipentylbenzene-1,2-diol |
|---|---|
| PubChem CID | 87876480 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 4-butyl-3,5-dipentylbenzene-1,2-diol |
| SMILES | CCCCCc1cc(O)c(O)c(CCCCC)c1CCCC |
| InChI | InChI=1S/C20H34O2/c1-4-7-10-12-16-15-19(21)20(22)18(14-11-8-5-2)17(16)13-9-6-3/h15,21-22H,4-14H2,1-3H3 |
| InChIKey | ABDVDJINLGYZRC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|