C36H58O3 — CID 177309933
2,3,4-tributyl-6-(3,4,5-tributyl-2-hydroxyphenoxy)phenol (PubChem CID 177309933) has the molecular formula C36H58O3 and a molecular weight of 538.86 g/mol. Its IUPAC name is 2,3,4-tributyl-6-(3,4,5-tributyl-2-hydroxyphenoxy)phenol.
| Compound Name | 2,3,4-tributyl-6-(3,4,5-tributyl-2-hydroxyphenoxy)phenol |
|---|---|
| PubChem CID | 177309933 |
| Molecular Formula | C36H58O3 |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 538.44 |
| IUPAC Name | 2,3,4-tributyl-6-(3,4,5-tributyl-2-hydroxyphenoxy)phenol |
| SMILES | CCCCc1cc(Oc2cc(CCCC)c(CCCC)c(CCCC)c2O)c(O)c(CCCC)c1CCCC |
| InChI | InChI=1S/C36H58O3/c1-7-13-19-27-25-33(35(37)31(23-17-11-5)29(27)21-15-9-3)39-34-26-28(20-14-8-2)30(22-16-10-4)32(36(34)38)24-18-12-6/h25-26,37-38H,7-24H2,1-6H3 |
| InChIKey | NIMHLRQJBXZUJM-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |