(5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate

C15H22O4 — CID 87876141

IUPAC(5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate
SMILESCCCCc1cc(OC(=O)O)c(O)c(CC)c1CC
InChIInChI=1S/C15H22O4/c1-4-7-8-10-9-13(19-15(17)18)14(16)12(6-3)11(10)5-2/h9,16H,4-8H2,1-3H3,(H,17,18)
InChIKeyKHEGDLDJOGLUSH-UHFFFAOYSA-N
MW266.34 g/mol
LogP3.92
Rot. Bonds6

About (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate

(5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate (PubChem CID 87876141) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate.

Molecular Properties

Compound Name(5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate
PubChem CID87876141
Molecular FormulaC15H22O4
Molecular Weight266.34 g/mol
Exact Mass266.15
IUPAC Name(5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate
SMILESCCCCc1cc(OC(=O)O)c(O)c(CC)c1CC
InChIInChI=1S/C15H22O4/c1-4-7-8-10-9-13(19-15(17)18)14(16)12(6-3)11(10)5-2/h9,16H,4-8H2,1-3H3,(H,17,18)
InChIKeyKHEGDLDJOGLUSH-UHFFFAOYSA-N
XLogP3.92
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 53.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate?
The IUPAC name of (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate (CID 87876141) is (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate.
What is the SMILES notation for (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate?
The canonical SMILES for (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate is CCCCc1cc(OC(=O)O)c(O)c(CC)c1CC.
What is the InChIKey of (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate?
The InChIKey is KHEGDLDJOGLUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-4-7-8-10-9-13(19-15(17)18)14(16)12(6-3)11(10)5-2/h9,16H,4-8H2,1-3H3,(H,17,18).
What are the key properties of (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate?
(5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate has a molecular weight of 266.34 g/mol, XLogP of 3.92, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-butyl-3,4-diethyl-2-hydroxyphenyl) hydrogen carbonate is sourced from PubChem (CID 87876141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).