C30H52O5 — CID 87860062
[2-hydroxy-4,5-di(nonyl)-3-pentoxyphenyl] hydrogen carbonate (PubChem CID 87860062) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is [2-hydroxy-4,5-di(nonyl)-3-pentoxyphenyl] hydrogen carbonate.
| Compound Name | [2-hydroxy-4,5-di(nonyl)-3-pentoxyphenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 87860062 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | [2-hydroxy-4,5-di(nonyl)-3-pentoxyphenyl] hydrogen carbonate |
| SMILES | CCCCCCCCCc1cc(OC(=O)O)c(O)c(OCCCCC)c1CCCCCCCCC |
| InChI | InChI=1S/C30H52O5/c1-4-7-10-12-14-16-18-21-25-24-27(35-30(32)33)28(31)29(34-23-20-9-6-3)26(25)22-19-17-15-13-11-8-5-2/h24,31H,4-23H2,1-3H3,(H,32,33) |
| InChIKey | BFVFLUFZPWSJSO-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|