About (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate
(5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate (PubChem CID 87874915) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate |
| PubChem CID | 87874915 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate |
| SMILES | CCc1cc(OC(=O)O)c(O)c(C)c1C |
| InChI | InChI=1S/C11H14O4/c1-4-8-5-9(15-11(13)14)10(12)7(3)6(8)2/h5,12H,4H2,1-3H3,(H,13,14) |
| InChIKey | YEOSUKIHPVVTJI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate?
The IUPAC name of (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate (CID 87874915) is (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate.
What is the SMILES notation for (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate?
The canonical SMILES for (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate is CCc1cc(OC(=O)O)c(O)c(C)c1C.
What is the InChIKey of (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate?
The InChIKey is YEOSUKIHPVVTJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-4-8-5-9(15-11(13)14)10(12)7(3)6(8)2/h5,12H,4H2,1-3H3,(H,13,14).
What are the key properties of (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate?
(5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate has a molecular weight of 210.23 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2-hydroxy-3,4-dimethylphenyl) hydrogen carbonate is sourced from PubChem (CID 87874915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).