C9H9IO4 — CID 87860408
(2-hydroxy-5-iodo-3,4-dimethylphenyl) hydrogen carbonate (PubChem CID 87860408) has the molecular formula C9H9IO4 and a molecular weight of 308.07 g/mol. Its IUPAC name is (2-hydroxy-5-iodo-3,4-dimethylphenyl) hydrogen carbonate.
| Compound Name | (2-hydroxy-5-iodo-3,4-dimethylphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87860408 |
| Molecular Formula | C9H9IO4 |
| Molecular Weight | 308.07 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | (2-hydroxy-5-iodo-3,4-dimethylphenyl) hydrogen carbonate |
| SMILES | Cc1c(I)cc(OC(=O)O)c(O)c1C |
| InChI | InChI=1S/C9H9IO4/c1-4-5(2)8(11)7(3-6(4)10)14-9(12)13/h3,11H,1-2H3,(H,12,13) |
| InChIKey | CZARZHYHEUORHY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.07 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|